C22H20Br2N4O3S — CID 18835679
(5,7-dibromoquinolin-8-yl) (4Z)-4-(carbamothioylhydrazinylidene)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxylate (PubChem CID 18835679) has the molecular formula C22H20Br2N4O3S and a molecular weight of 580.30 g/mol. Its IUPAC name is (5,7-dibromoquinolin-8-yl) (4Z)-4-(carbamothioylhydrazinylidene)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxylate.
| Compound Name | (5,7-dibromoquinolin-8-yl) (4Z)-4-(carbamothioylhydrazinylidene)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 18835679 |
| Molecular Formula | C22H20Br2N4O3S |
| Molecular Weight | 580.30 g/mol |
| Exact Mass | 577.96 |
| IUPAC Name | (5,7-dibromoquinolin-8-yl) (4Z)-4-(carbamothioylhydrazinylidene)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2c(Br)cc(Br)c3cccnc23)oc2c1/C(=N\NC(N)=S)CC(C)(C)C2 |
| InChI | InChI=1S/C22H20Br2N4O3S/c1-10-16-14(27-28-21(25)32)8-22(2,3)9-15(16)30-18(10)20(29)31-19-13(24)7-12(23)11-5-4-6-26-17(11)19/h4-7H,8-9H2,1-3H3,(H3,25,28,32)/b27-14- |
| InChIKey | DXAIVCOPGALVME-VYYCAZPPSA-N |
| XLogP | 5.39 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|