C19H18N2O3S — CID 18836083
N-(5-benzyl-1,3-thiazol-2-yl)-2-(3-methoxyphenoxy)acetamide (PubChem CID 18836083) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-2-(3-methoxyphenoxy)acetamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(3-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 18836083 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(3-methoxyphenoxy)acetamide |
| SMILES | COc1cccc(OCC(=O)Nc2ncc(Cc3ccccc3)s2)c1 |
| InChI | InChI=1S/C19H18N2O3S/c1-23-15-8-5-9-16(11-15)24-13-18(22)21-19-20-12-17(25-19)10-14-6-3-2-4-7-14/h2-9,11-12H,10,13H2,1H3,(H,20,21,22) |
| InChIKey | BXOOHGJISICXAE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |