C27H26N4O4S — CID 18836553
N-(4-ethoxyphenyl)-2-[(2Z)-4-oxo-2-[(E)-(5-phenylfuran-2-yl)methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide (PubChem CID 18836553) has the molecular formula C27H26N4O4S and a molecular weight of 502.60 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[(2Z)-4-oxo-2-[(E)-(5-phenylfuran-2-yl)methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[(2Z)-4-oxo-2-[(E)-(5-phenylfuran-2-yl)methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 18836553 |
| Molecular Formula | C27H26N4O4S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[(2Z)-4-oxo-2-[(E)-(5-phenylfuran-2-yl)methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide |
| SMILES | C=CCN1C(=O)C(CC(=O)Nc2ccc(OCC)cc2)S/C1=N\N=C\c1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C27H26N4O4S/c1-3-16-31-26(33)24(17-25(32)29-20-10-12-21(13-11-20)34-4-2)36-27(31)30-28-18-22-14-15-23(35-22)19-8-6-5-7-9-19/h3,5-15,18,24H,1,4,16-17H2,2H3,(H,29,32)/b28-18+,30-27- |
| InChIKey | XERXQOASCKUEOX-QRGJOVSOSA-N |
| XLogP | 5.19 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|