About N-methylheptanamide
N-methylheptanamide (PubChem CID 18838) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is N-methylheptanamide.
Molecular Properties
| Compound Name | N-methylheptanamide |
| PubChem CID | 18838 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | N-methylheptanamide |
| SMILES | CCCCCCC(=O)NC |
| InChI | InChI=1S/C8H17NO/c1-3-4-5-6-7-8(10)9-2/h3-7H2,1-2H3,(H,9,10) |
| InChIKey | PRCOHDSOXCGBAX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylheptanamide?
The IUPAC name of N-methylheptanamide (CID 18838) is N-methylheptanamide.
What is the SMILES notation for N-methylheptanamide?
The canonical SMILES for N-methylheptanamide is CCCCCCC(=O)NC.
What is the InChIKey of N-methylheptanamide?
The InChIKey is PRCOHDSOXCGBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-3-4-5-6-7-8(10)9-2/h3-7H2,1-2H3,(H,9,10).
What are the key properties of N-methylheptanamide?
N-methylheptanamide has a molecular weight of 143.23 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylheptanamide is sourced from PubChem (CID 18838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).