C15H18N2OS — CID 18838722
(5Z)-3-ethyl-2-ethylimino-5-[(2-methylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 18838722) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is (5Z)-3-ethyl-2-ethylimino-5-[(2-methylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-ethyl-2-ethylimino-5-[(2-methylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18838722 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (5Z)-3-ethyl-2-ethylimino-5-[(2-methylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC/N=C1/S/C(=C\c2ccccc2C)C(=O)N1CC |
| InChI | InChI=1S/C15H18N2OS/c1-4-16-15-17(5-2)14(18)13(19-15)10-12-9-7-6-8-11(12)3/h6-10H,4-5H2,1-3H3/b13-10-,16-15+ |
| InChIKey | PLTJIVZLNHTLSP-IKKSVTPCSA-N |
| XLogP | 3.31 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|