C20H32N2O3 — CID 18839386
N-[(2,2-dimethylpropanoylamino)-(4-propoxyphenyl)methyl]-2,2-dimethylpropanamide (PubChem CID 18839386) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[(2,2-dimethylpropanoylamino)-(4-propoxyphenyl)methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2,2-dimethylpropanoylamino)-(4-propoxyphenyl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18839386 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | N-[(2,2-dimethylpropanoylamino)-(4-propoxyphenyl)methyl]-2,2-dimethylpropanamide |
| SMILES | CCCOc1ccc(C(NC(=O)C(C)(C)C)NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32N2O3/c1-8-13-25-15-11-9-14(10-12-15)16(21-17(23)19(2,3)4)22-18(24)20(5,6)7/h9-12,16H,8,13H2,1-7H3,(H,21,23)(H,22,24) |
| InChIKey | VZKPBEQYLDGDRQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|