C20H32N2O3 — CID 18839396
N-[(pentanoylamino)-(4-propan-2-yloxyphenyl)methyl]pentanamide (PubChem CID 18839396) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[(pentanoylamino)-(4-propan-2-yloxyphenyl)methyl]pentanamide.
| Compound Name | N-[(pentanoylamino)-(4-propan-2-yloxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 18839396 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | N-[(pentanoylamino)-(4-propan-2-yloxyphenyl)methyl]pentanamide |
| SMILES | CCCCC(=O)NC(NC(=O)CCCC)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C20H32N2O3/c1-5-7-9-18(23)21-20(22-19(24)10-8-6-2)16-11-13-17(14-12-16)25-15(3)4/h11-15,20H,5-10H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | SLKMATDQZOLSLL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|