C26H28N2O5 — CID 18839457
2-(4-methoxyphenyl)-N-[(2-methoxyphenyl)-[[2-(4-methoxyphenyl)acetyl]amino]methyl]acetamide (PubChem CID 18839457) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[(2-methoxyphenyl)-[[2-(4-methoxyphenyl)acetyl]amino]methyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[(2-methoxyphenyl)-[[2-(4-methoxyphenyl)acetyl]amino]methyl]acetamide |
|---|---|
| PubChem CID | 18839457 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[(2-methoxyphenyl)-[[2-(4-methoxyphenyl)acetyl]amino]methyl]acetamide |
| SMILES | COc1ccc(CC(=O)NC(NC(=O)Cc2ccc(OC)cc2)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C26H28N2O5/c1-31-20-12-8-18(9-13-20)16-24(29)27-26(22-6-4-5-7-23(22)33-3)28-25(30)17-19-10-14-21(32-2)15-11-19/h4-15,26H,16-17H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | VYRBMUDJKZWVRO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|