C20H20N2O2S — CID 18839916
(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-(2,4-dimethylphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 18839916) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-(2,4-dimethylphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-(2,4-dimethylphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18839916 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-(2,4-dimethylphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)S/C(=C\c3ccc(N(C)C)cc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H20N2O2S/c1-13-5-10-17(14(2)11-13)22-19(23)18(25-20(22)24)12-15-6-8-16(9-7-15)21(3)4/h5-12H,1-4H3/b18-12- |
| InChIKey | ZNXYWHYZTRULPC-PDGQHHTCSA-N |
| XLogP | 4.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|