C18H13Cl2NO2S — CID 18840004
(5Z)-5-[(2,6-dichlorophenyl)methylidene]-3-(2,5-dimethylphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 18840004) has the molecular formula C18H13Cl2NO2S and a molecular weight of 378.28 g/mol. Its IUPAC name is (5Z)-5-[(2,6-dichlorophenyl)methylidene]-3-(2,5-dimethylphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2,6-dichlorophenyl)methylidene]-3-(2,5-dimethylphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18840004 |
| Molecular Formula | C18H13Cl2NO2S |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | (5Z)-5-[(2,6-dichlorophenyl)methylidene]-3-(2,5-dimethylphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)S/C(=C\c3c(Cl)cccc3Cl)C2=O)c1 |
| InChI | InChI=1S/C18H13Cl2NO2S/c1-10-6-7-11(2)15(8-10)21-17(22)16(24-18(21)23)9-12-13(19)4-3-5-14(12)20/h3-9H,1-2H3/b16-9- |
| InChIKey | QSLWMWMOKSWEBG-SXGWCWSVSA-N |
| XLogP | 5.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|