C18H11ClN2O3S — CID 18840537
(5Z)-3-(4-chlorophenyl)-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 18840537) has the molecular formula C18H11ClN2O3S and a molecular weight of 370.82 g/mol. Its IUPAC name is (5Z)-3-(4-chlorophenyl)-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(4-chlorophenyl)-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18840537 |
| Molecular Formula | C18H11ClN2O3S |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | (5Z)-3-(4-chlorophenyl)-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)/C(=C2\SC(=O)N(c3ccc(Cl)cc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C18H11ClN2O3S/c1-20-13-5-3-2-4-12(13)14(16(20)22)15-17(23)21(18(24)25-15)11-8-6-10(19)7-9-11/h2-9H,1H3/b15-14- |
| InChIKey | MVIJDXVAQLRXPX-PFONDFGASA-N |
| XLogP | 3.93 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|