C19H21NO4S2 — CID 18841443
4-methyl-2-[(5Z)-4-oxo-5-[(4-prop-2-enoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid (PubChem CID 18841443) has the molecular formula C19H21NO4S2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 4-methyl-2-[(5Z)-4-oxo-5-[(4-prop-2-enoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid.
| Compound Name | 4-methyl-2-[(5Z)-4-oxo-5-[(4-prop-2-enoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 18841443 |
| Molecular Formula | C19H21NO4S2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 4-methyl-2-[(5Z)-4-oxo-5-[(4-prop-2-enoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
| SMILES | C=CCOc1ccc(/C=C2\SC(=S)N(C(CC(C)C)C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C19H21NO4S2/c1-4-9-24-14-7-5-13(6-8-14)11-16-17(21)20(19(25)26-16)15(18(22)23)10-12(2)3/h4-8,11-12,15H,1,9-10H2,2-3H3,(H,22,23)/b16-11- |
| InChIKey | ZRNPEVYSRABBAK-WJDWOHSUSA-N |
| XLogP | 3.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|