C19H14N4O3S — CID 18841787
(2E,5Z)-5-(1-acetyl-2-oxoindol-3-ylidene)-3-methyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 18841787) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is (2E,5Z)-5-(1-acetyl-2-oxoindol-3-ylidene)-3-methyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-(1-acetyl-2-oxoindol-3-ylidene)-3-methyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18841787 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (2E,5Z)-5-(1-acetyl-2-oxoindol-3-ylidene)-3-methyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CC(=O)N1C(=O)/C(=C2\S/C(=N/c3ccccn3)N(C)C2=O)c2ccccc21 |
| InChI | InChI=1S/C19H14N4O3S/c1-11(24)23-13-8-4-3-7-12(13)15(17(23)25)16-18(26)22(2)19(27-16)21-14-9-5-6-10-20-14/h3-10H,1-2H3/b16-15-,21-19+ |
| InChIKey | CQHRULFYVMJHNY-NQZNYCRESA-N |
| XLogP | 2.58 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|