C17H14FN3OS — CID 18842695
(2E,5Z)-5-[(2-fluorophenyl)methylidene]-3-methyl-2-[(6-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one (PubChem CID 18842695) has the molecular formula C17H14FN3OS and a molecular weight of 327.38 g/mol. Its IUPAC name is (2E,5Z)-5-[(2-fluorophenyl)methylidene]-3-methyl-2-[(6-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(2-fluorophenyl)methylidene]-3-methyl-2-[(6-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18842695 |
| Molecular Formula | C17H14FN3OS |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (2E,5Z)-5-[(2-fluorophenyl)methylidene]-3-methyl-2-[(6-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(/N=C2/S/C(=C\c3ccccc3F)C(=O)N2C)n1 |
| InChI | InChI=1S/C17H14FN3OS/c1-11-6-5-9-15(19-11)20-17-21(2)16(22)14(23-17)10-12-7-3-4-8-13(12)18/h3-10H,1-2H3/b14-10-,20-17+ |
| InChIKey | JOLCEVJCLRRHMY-CJXQYUSSSA-N |
| XLogP | 3.76 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|