C24H19N3O3S — CID 18843003
methyl 4-[(Z)-[(2E)-2-[(6-methyl-2-pyridinyl)imino]-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 18843003) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is methyl 4-[(Z)-[(2E)-2-[(6-methyl-2-pyridinyl)imino]-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[(2E)-2-[(6-methyl-2-pyridinyl)imino]-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 18843003 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | methyl 4-[(Z)-[(2E)-2-[(6-methyl-2-pyridinyl)imino]-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\S/C(=N/c3cccc(C)n3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H19N3O3S/c1-16-7-6-10-21(25-16)26-24-27(19-8-4-3-5-9-19)22(28)20(31-24)15-17-11-13-18(14-12-17)23(29)30-2/h3-15H,1-2H3/b20-15-,26-24+ |
| InChIKey | BMTCBHNPPNEQQR-UVFCNREVSA-N |
| XLogP | 4.99 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|