C22H19N3O2S2 — CID 18844210
(2E,5Z)-3-methyl-5-[[4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 18844210) has the molecular formula C22H19N3O2S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (2E,5Z)-3-methyl-5-[[4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-methyl-5-[[4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844210 |
| Molecular Formula | C22H19N3O2S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | (2E,5Z)-3-methyl-5-[[4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(COc2ccc(/C=C3\S/C(=N/c4nccs4)N(C)C3=O)cc2)cc1 |
| InChI | InChI=1S/C22H19N3O2S2/c1-15-3-5-17(6-4-15)14-27-18-9-7-16(8-10-18)13-19-20(26)25(2)22(29-19)24-21-23-11-12-28-21/h3-13H,14H2,1-2H3/b19-13-,24-22+ |
| InChIKey | GRHOLWMZYTZLGU-ZOVWXIRQSA-N |
| XLogP | 5.26 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|