C18H19N3O4S2 — CID 18844746
(2E,5Z)-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 18844746) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (2E,5Z)-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844746 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (2E,5Z)-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3nc(C)cs3)N(C)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N3O4S2/c1-10-9-26-17(19-10)20-18-21(2)16(22)14(27-18)8-11-6-12(23-3)15(25-5)13(7-11)24-4/h6-9H,1-5H3/b14-8-,20-18+ |
| InChIKey | BPRMWVCEVIFWJM-PCIISTMISA-N |
| XLogP | 3.71 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|