C16H16N4OS2 — CID 18844781
(2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 18844781) has the molecular formula C16H16N4OS2 and a molecular weight of 344.47 g/mol. Its IUPAC name is (2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844781 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | C/C(=C1/S/C(=N/c2nc(C)cs2)N(C)C1=O)c1cccc(N)c1 |
| InChI | InChI=1S/C16H16N4OS2/c1-9-8-22-15(18-9)19-16-20(3)14(21)13(23-16)10(2)11-5-4-6-12(17)7-11/h4-8H,17H2,1-3H3/b13-10-,19-16+ |
| InChIKey | YFHXYSJNQDFLJV-LPDGQVOVSA-N |
| XLogP | 3.66 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|