C17H16ClN3OS2 — CID 18844876
(2E,5Z)-5-[1-(4-chlorophenyl)ethylidene]-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 18844876) has the molecular formula C17H16ClN3OS2 and a molecular weight of 377.92 g/mol. Its IUPAC name is (2E,5Z)-5-[1-(4-chlorophenyl)ethylidene]-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[1-(4-chlorophenyl)ethylidene]-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844876 |
| Molecular Formula | C17H16ClN3OS2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (2E,5Z)-5-[1-(4-chlorophenyl)ethylidene]-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C(\C)c2ccc(Cl)cc2)S/C1=N/c1nc(C)cs1 |
| InChI | InChI=1S/C17H16ClN3OS2/c1-4-21-15(22)14(11(3)12-5-7-13(18)8-6-12)24-17(21)20-16-19-10(2)9-23-16/h5-9H,4H2,1-3H3/b14-11-,20-17+ |
| InChIKey | PJGJRTWTNQMUTH-AJTXDVGESA-N |
| XLogP | 5.12 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|