C17H17N5OS2 — CID 18846010
(2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18846010) has the molecular formula C17H17N5OS2 and a molecular weight of 371.49 g/mol. Its IUPAC name is (2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18846010 |
| Molecular Formula | C17H17N5OS2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C(\C)c2cccc(N)c2)S/C1=N/c1nnc(C)s1 |
| InChI | InChI=1S/C17H17N5OS2/c1-4-8-22-15(23)14(10(2)12-6-5-7-13(18)9-12)25-17(22)19-16-21-20-11(3)24-16/h4-7,9H,1,8,18H2,2-3H3/b14-10-,19-17+ |
| InChIKey | BFLLZIRAQFDOCZ-MJBRBLHISA-N |
| XLogP | 3.61 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|