C17H19N5OS2 — CID 18846165
(2E,5E)-3-cyclohexyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 18846165) has the molecular formula C17H19N5OS2 and a molecular weight of 373.51 g/mol. Its IUPAC name is (2E,5E)-3-cyclohexyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-cyclohexyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18846165 |
| Molecular Formula | C17H19N5OS2 |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (2E,5E)-3-cyclohexyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | Cc1nnc(/N=C2/S/C(=C/c3ccc[nH]3)C(=O)N2C2CCCCC2)s1 |
| InChI | InChI=1S/C17H19N5OS2/c1-11-20-21-16(24-11)19-17-22(13-7-3-2-4-8-13)15(23)14(25-17)10-12-6-5-9-18-12/h5-6,9-10,13,18H,2-4,7-8H2,1H3/b14-10+,19-17+ |
| InChIKey | DUGXFARGSYXFFS-KOJZBUGZSA-N |
| XLogP | 4.11 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|