C20H15ClN2O3S — CID 18846437
3-[[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 18846437) has the molecular formula C20H15ClN2O3S and a molecular weight of 398.87 g/mol. Its IUPAC name is 3-[[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 18846437 |
| Molecular Formula | C20H15ClN2O3S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 3-[[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | C=CCN1C(=O)/C(=C/c2ccccc2Cl)S/C1=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H15ClN2O3S/c1-2-10-23-18(24)17(12-13-6-3-4-9-16(13)21)27-20(23)22-15-8-5-7-14(11-15)19(25)26/h2-9,11-12H,1,10H2,(H,25,26)/b17-12-,22-20+ |
| InChIKey | UWDFBPWTZBWWTI-RORPNGENSA-N |
| XLogP | 4.83 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|