About 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline
7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline (PubChem CID 18846762) has the molecular formula C19H18N2
and a molecular weight of 274.37 g/mol. Its IUPAC name is 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline.
Molecular Properties
| Compound Name | 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline |
| PubChem CID | 18846762 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline |
| SMILES | Cc1ccc2cc3c(nc2c1)N(c1ccccc1C)CC3 |
| InChI | InChI=1S/C19H18N2/c1-13-7-8-15-12-16-9-10-21(19(16)20-17(15)11-13)18-6-4-3-5-14(18)2/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | VLPIQTCCICVIRA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline?
The IUPAC name of 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline (CID 18846762) is 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline.
What is the SMILES notation for 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline?
The canonical SMILES for 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline is Cc1ccc2cc3c(nc2c1)N(c1ccccc1C)CC3.
What is the InChIKey of 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline?
The InChIKey is VLPIQTCCICVIRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2/c1-13-7-8-15-12-16-9-10-21(19(16)20-17(15)11-13)18-6-4-3-5-14(18)2/h3-8,11-12H,9-10H2,1-2H3.
What are the key properties of 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline?
7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline has a molecular weight of 274.37 g/mol, XLogP of 4.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1-(2-methylphenyl)-2,3-dihydropyrrolo[2,3-b]quinoline is sourced from PubChem (CID 18846762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).