About 3-methylhex-1-ene
3-methylhex-1-ene (PubChem CID 18848) has the molecular formula C7H14
and a molecular weight of 98.19 g/mol. Its IUPAC name is 3-methylhex-1-ene.
Molecular Properties
| Compound Name | 3-methylhex-1-ene |
| PubChem CID | 18848 |
| Molecular Formula | C7H14 |
| Molecular Weight | 98.19 g/mol |
| Exact Mass | 98.11 |
| IUPAC Name | 3-methylhex-1-ene |
| SMILES | C=CC(C)CCC |
| InChI | InChI=1S/C7H14/c1-4-6-7(3)5-2/h5,7H,2,4,6H2,1,3H3 |
| InChIKey | RITONZMLZWYPHW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhex-1-ene?
The IUPAC name of 3-methylhex-1-ene (CID 18848) is 3-methylhex-1-ene.
What is the SMILES notation for 3-methylhex-1-ene?
The canonical SMILES for 3-methylhex-1-ene is C=CC(C)CCC.
What is the InChIKey of 3-methylhex-1-ene?
The InChIKey is RITONZMLZWYPHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14/c1-4-6-7(3)5-2/h5,7H,2,4,6H2,1,3H3.
What are the key properties of 3-methylhex-1-ene?
3-methylhex-1-ene has a molecular weight of 98.19 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhex-1-ene is sourced from PubChem (CID 18848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).