C28H23BrClNO4 — CID 18855024
7-bromo-2-(3-chlorophenyl)-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18855024) has the molecular formula C28H23BrClNO4 and a molecular weight of 552.85 g/mol. Its IUPAC name is 7-bromo-2-(3-chlorophenyl)-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-2-(3-chlorophenyl)-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18855024 |
| Molecular Formula | C28H23BrClNO4 |
| Molecular Weight | 552.85 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | 7-bromo-2-(3-chlorophenyl)-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1cccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C28H23BrClNO4/c1-2-3-4-13-34-21-10-5-7-17(14-21)25-24-26(32)22-15-18(29)11-12-23(22)35-27(24)28(33)31(25)20-9-6-8-19(30)16-20/h5-12,14-16,25H,2-4,13H2,1H3 |
| InChIKey | BYUJQGKLPUOCKF-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.85 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|