C23H12F3NO3 — CID 18855423
7-fluoro-1,2-bis(4-fluorophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18855423) has the molecular formula C23H12F3NO3 and a molecular weight of 407.35 g/mol. Its IUPAC name is 7-fluoro-1,2-bis(4-fluorophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-fluoro-1,2-bis(4-fluorophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18855423 |
| Molecular Formula | C23H12F3NO3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 7-fluoro-1,2-bis(4-fluorophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1c2oc3ccc(F)cc3c(=O)c2C(c2ccc(F)cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H12F3NO3/c24-13-3-1-12(2-4-13)20-19-21(28)17-11-15(26)7-10-18(17)30-22(19)23(29)27(20)16-8-5-14(25)6-9-16/h1-11,20H |
| InChIKey | CDJGEYRDKYRCFS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |