C26H17BrFNO4 — CID 18855733
2-(3-bromophenyl)-7-fluoro-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18855733) has the molecular formula C26H17BrFNO4 and a molecular weight of 506.33 g/mol. Its IUPAC name is 2-(3-bromophenyl)-7-fluoro-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(3-bromophenyl)-7-fluoro-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18855733 |
| Molecular Formula | C26H17BrFNO4 |
| Molecular Weight | 506.33 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | 2-(3-bromophenyl)-7-fluoro-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(F)cc4c3=O)C(=O)N2c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C26H17BrFNO4/c1-2-12-32-19-9-6-15(7-10-19)23-22-24(30)20-14-17(28)8-11-21(20)33-25(22)26(31)29(23)18-5-3-4-16(27)13-18/h2-11,13-14,23H,1,12H2 |
| InChIKey | UXOPGSYSOLVNIC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.33 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|