C32H33NO5 — CID 18858134
1-(4-butoxy-3-ethoxyphenyl)-2-(3,4-dimethylphenyl)-7-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18858134) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is 1-(4-butoxy-3-ethoxyphenyl)-2-(3,4-dimethylphenyl)-7-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxy-3-ethoxyphenyl)-2-(3,4-dimethylphenyl)-7-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18858134 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1-(4-butoxy-3-ethoxyphenyl)-2-(3,4-dimethylphenyl)-7-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(C)cc4c3=O)C(=O)N2c2ccc(C)c(C)c2)cc1OCC |
| InChI | InChI=1S/C32H33NO5/c1-6-8-15-37-26-14-11-22(18-27(26)36-7-2)29-28-30(34)24-16-19(3)9-13-25(24)38-31(28)32(35)33(29)23-12-10-20(4)21(5)17-23/h9-14,16-18,29H,6-8,15H2,1-5H3 |
| InChIKey | FDTZANCRDPFIGD-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|