C27H24N4O2 — CID 18859092
4-methyl-N'-[4-(7-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)benzoyl]benzohydrazide (PubChem CID 18859092) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 4-methyl-N'-[4-(7-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)benzoyl]benzohydrazide.
| Compound Name | 4-methyl-N'-[4-(7-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 18859092 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-methyl-N'-[4-(7-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)benzoyl]benzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2ccc(N3CCc4cc5ccc(C)cc5nc43)cc2)cc1 |
| InChI | InChI=1S/C27H24N4O2/c1-17-3-6-19(7-4-17)26(32)29-30-27(33)20-9-11-23(12-10-20)31-14-13-22-16-21-8-5-18(2)15-24(21)28-25(22)31/h3-12,15-16H,13-14H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | RDBNADWXTCBADF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|