C29H27N3O4S — CID 18859199
methyl 2-[[4-(7-methoxy-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18859199) has the molecular formula C29H27N3O4S and a molecular weight of 513.62 g/mol. Its IUPAC name is methyl 2-[[4-(7-methoxy-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-(7-methoxy-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18859199 |
| Molecular Formula | C29H27N3O4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | methyl 2-[[4-(7-methoxy-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccc(N3CCc4cc5ccc(OC)cc5nc43)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C29H27N3O4S/c1-35-21-12-9-18-15-19-13-14-32(26(19)30-23(18)16-21)20-10-7-17(8-11-20)27(33)31-28-25(29(34)36-2)22-5-3-4-6-24(22)37-28/h7-12,15-16H,3-6,13-14H2,1-2H3,(H,31,33) |
| InChIKey | OEBKKHGSKXGVNR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |