C19H18N2O5S2 — CID 18859762
14-(2-morpholin-4-yl-2-oxoethyl)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-9,15-dione (PubChem CID 18859762) has the molecular formula C19H18N2O5S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 14-(2-morpholin-4-yl-2-oxoethyl)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-9,15-dione.
| Compound Name | 14-(2-morpholin-4-yl-2-oxoethyl)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-9,15-dione |
|---|---|
| PubChem CID | 18859762 |
| Molecular Formula | C19H18N2O5S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 14-(2-morpholin-4-yl-2-oxoethyl)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-9,15-dione |
| SMILES | O=C1Oc2ccccc2C2c3sc(=O)n(CC(=O)N4CCOCC4)c3SCC12 |
| InChI | InChI=1S/C19H18N2O5S2/c22-14(20-5-7-25-8-6-20)9-21-17-16(28-19(21)24)15-11-3-1-2-4-13(11)26-18(23)12(15)10-27-17/h1-4,12,15H,5-10H2 |
| InChIKey | IFWTVFYISGYPCF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|