C19H24Cl2N2O2 — CID 18860071
N-[(Z)-1-(2,6-dichlorophenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2,2-dimethylpropanamide (PubChem CID 18860071) has the molecular formula C19H24Cl2N2O2 and a molecular weight of 383.32 g/mol. Its IUPAC name is N-[(Z)-1-(2,6-dichlorophenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18860071 |
| Molecular Formula | C19H24Cl2N2O2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N/C(=C\c1c(Cl)cccc1Cl)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H24Cl2N2O2/c1-19(2,3)18(25)22-16(17(24)23-10-5-4-6-11-23)12-13-14(20)8-7-9-15(13)21/h7-9,12H,4-6,10-11H2,1-3H3,(H,22,25)/b16-12- |
| InChIKey | PCHJBLUFBRPTDV-VBKFSLOCSA-N |
| XLogP | 4.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|