C26H36Cl2N2O2 — CID 18860073
N-[(E)-1-(2,6-dichlorophenyl)-3-(dicyclohexylamino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide (PubChem CID 18860073) has the molecular formula C26H36Cl2N2O2 and a molecular weight of 479.49 g/mol. Its IUPAC name is N-[(E)-1-(2,6-dichlorophenyl)-3-(dicyclohexylamino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(E)-1-(2,6-dichlorophenyl)-3-(dicyclohexylamino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18860073 |
| Molecular Formula | C26H36Cl2N2O2 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[(E)-1-(2,6-dichlorophenyl)-3-(dicyclohexylamino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N/C(=C/c1c(Cl)cccc1Cl)C(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H36Cl2N2O2/c1-26(2,3)25(32)29-23(17-20-21(27)15-10-16-22(20)28)24(31)30(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h10,15-19H,4-9,11-14H2,1-3H3,(H,29,32)/b23-17+ |
| InChIKey | JWRLBJRZXYAVIZ-HAVVHWLPSA-N |
| XLogP | 6.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|