C30H38N2O4S — CID 18861583
N-[4-(dicyclohexylsulfamoyl)phenyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide (PubChem CID 18861583) has the molecular formula C30H38N2O4S and a molecular weight of 522.71 g/mol. Its IUPAC name is N-[4-(dicyclohexylsulfamoyl)phenyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[4-(dicyclohexylsulfamoyl)phenyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 18861583 |
| Molecular Formula | C30H38N2O4S |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | N-[4-(dicyclohexylsulfamoyl)phenyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide |
| SMILES | Cc1ccc2c(CC(=O)Nc3ccc(S(=O)(=O)N(C4CCCCC4)C4CCCCC4)cc3)coc2c1C |
| InChI | InChI=1S/C30H38N2O4S/c1-21-13-18-28-23(20-36-30(28)22(21)2)19-29(33)31-24-14-16-27(17-15-24)37(34,35)32(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h13-18,20,25-26H,3-12,19H2,1-2H3,(H,31,33) |
| InChIKey | WLSRIYPIIUWYHC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |