About acridin-9-ylhydrazine
acridin-9-ylhydrazine (PubChem CID 18864) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is acridin-9-ylhydrazine.
Molecular Properties
| Compound Name | acridin-9-ylhydrazine |
| PubChem CID | 18864 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | acridin-9-ylhydrazine |
| SMILES | NNc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C13H11N3/c14-16-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,14H2,(H,15,16) |
| InChIKey | SVANEUDZNISLJD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridin-9-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridin-9-ylhydrazine?
The IUPAC name of acridin-9-ylhydrazine (CID 18864) is acridin-9-ylhydrazine.
What is the SMILES notation for acridin-9-ylhydrazine?
The canonical SMILES for acridin-9-ylhydrazine is NNc1c2ccccc2nc2ccccc12.
What is the InChIKey of acridin-9-ylhydrazine?
The InChIKey is SVANEUDZNISLJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c14-16-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,14H2,(H,15,16).
What are the key properties of acridin-9-ylhydrazine?
acridin-9-ylhydrazine has a molecular weight of 209.25 g/mol, XLogP of 2.67, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acridin-9-ylhydrazine is sourced from PubChem (CID 18864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).