C31H22BrN3O3S — CID 18865137
(5'Z)-9-bromo-5'-[(4-hydroxyphenyl)methylidene]-2,3'-diphenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 18865137) has the molecular formula C31H22BrN3O3S and a molecular weight of 596.51 g/mol. Its IUPAC name is (5'Z)-9-bromo-5'-[(4-hydroxyphenyl)methylidene]-2,3'-diphenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | (5'Z)-9-bromo-5'-[(4-hydroxyphenyl)methylidene]-2,3'-diphenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 18865137 |
| Molecular Formula | C31H22BrN3O3S |
| Molecular Weight | 596.51 g/mol |
| Exact Mass | 595.06 |
| IUPAC Name | (5'Z)-9-bromo-5'-[(4-hydroxyphenyl)methylidene]-2,3'-diphenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1S/C(=C\c2ccc(O)cc2)C2(Oc3ccc(Br)cc3C3CC(c4ccccc4)=NN32)N1c1ccccc1 |
| InChI | InChI=1S/C31H22BrN3O3S/c32-22-13-16-28-25(18-22)27-19-26(21-7-3-1-4-8-21)33-35(27)31(38-28)29(17-20-11-14-24(36)15-12-20)39-30(37)34(31)23-9-5-2-6-10-23/h1-18,27,36H,19H2/b29-17- |
| InChIKey | JBQBPJVQSIKEGO-RHANQZHGSA-N |
| XLogP | 7.77 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.51 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|