C31H21BrFN3O2S — CID 18865145
(5'Z)-9-bromo-5'-[(4-fluorophenyl)methylidene]-2,3'-diphenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 18865145) has the molecular formula C31H21BrFN3O2S and a molecular weight of 598.50 g/mol. Its IUPAC name is (5'Z)-9-bromo-5'-[(4-fluorophenyl)methylidene]-2,3'-diphenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | (5'Z)-9-bromo-5'-[(4-fluorophenyl)methylidene]-2,3'-diphenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 18865145 |
| Molecular Formula | C31H21BrFN3O2S |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 597.05 |
| IUPAC Name | (5'Z)-9-bromo-5'-[(4-fluorophenyl)methylidene]-2,3'-diphenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1S/C(=C\c2ccc(F)cc2)C2(Oc3ccc(Br)cc3C3CC(c4ccccc4)=NN32)N1c1ccccc1 |
| InChI | InChI=1S/C31H21BrFN3O2S/c32-22-13-16-28-25(18-22)27-19-26(21-7-3-1-4-8-21)34-36(27)31(38-28)29(17-20-11-14-23(33)15-12-20)39-30(37)35(31)24-9-5-2-6-10-24/h1-18,27H,19H2/b29-17- |
| InChIKey | FPNZTZNQMHZOFV-RHANQZHGSA-N |
| XLogP | 8.20 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|