C19H16ClN3OS — CID 18866250
2-(2-chlorophenyl)-3-(2-ethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile (PubChem CID 18866250) has the molecular formula C19H16ClN3OS and a molecular weight of 369.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-(2-ethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile.
| Compound Name | 2-(2-chlorophenyl)-3-(2-ethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 18866250 |
| Molecular Formula | C19H16ClN3OS |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-(2-chlorophenyl)-3-(2-ethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
| SMILES | CCc1ccccc1N1C(S)=C(C#N)C(=O)NC1c1ccccc1Cl |
| InChI | InChI=1S/C19H16ClN3OS/c1-2-12-7-3-6-10-16(12)23-17(13-8-4-5-9-15(13)20)22-18(24)14(11-21)19(23)25/h3-10,17,25H,2H2,1H3,(H,22,24) |
| InChIKey | VRSPOLGHTAPFHJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|