C23H25N3OS — CID 18866280
2-(4-tert-butylphenyl)-3-(2,5-dimethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile (PubChem CID 18866280) has the molecular formula C23H25N3OS and a molecular weight of 391.54 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-3-(2,5-dimethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile.
| Compound Name | 2-(4-tert-butylphenyl)-3-(2,5-dimethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 18866280 |
| Molecular Formula | C23H25N3OS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-(4-tert-butylphenyl)-3-(2,5-dimethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
| SMILES | Cc1ccc(C)c(N2C(S)=C(C#N)C(=O)NC2c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H25N3OS/c1-14-6-7-15(2)19(12-14)26-20(25-21(27)18(13-24)22(26)28)16-8-10-17(11-9-16)23(3,4)5/h6-12,20,28H,1-5H3,(H,25,27) |
| InChIKey | FXUUQAJCBLJKFC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|