C19H16BrN3OS — CID 18866409
2-(3-bromophenyl)-3-(3,4-dimethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile (PubChem CID 18866409) has the molecular formula C19H16BrN3OS and a molecular weight of 414.33 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-(3,4-dimethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile.
| Compound Name | 2-(3-bromophenyl)-3-(3,4-dimethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 18866409 |
| Molecular Formula | C19H16BrN3OS |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 2-(3-bromophenyl)-3-(3,4-dimethylphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
| SMILES | Cc1ccc(N2C(S)=C(C#N)C(=O)NC2c2cccc(Br)c2)cc1C |
| InChI | InChI=1S/C19H16BrN3OS/c1-11-6-7-15(8-12(11)2)23-17(13-4-3-5-14(20)9-13)22-18(24)16(10-21)19(23)25/h3-9,17,25H,1-2H3,(H,22,24) |
| InChIKey | KKNFZEPGVSHHNV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|