About 2-methoxyacridin-9-amine
2-methoxyacridin-9-amine (PubChem CID 18867) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-methoxyacridin-9-amine.
Molecular Properties
| Compound Name | 2-methoxyacridin-9-amine |
| PubChem CID | 18867 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-methoxyacridin-9-amine |
| SMILES | COc1ccc2nc3ccccc3c(N)c2c1 |
| InChI | InChI=1S/C14H12N2O/c1-17-9-6-7-13-11(8-9)14(15)10-4-2-3-5-12(10)16-13/h2-8H,1H3,(H2,15,16) |
| InChIKey | MPQHRPVQJUEINF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyacridin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyacridin-9-amine?
The IUPAC name of 2-methoxyacridin-9-amine (CID 18867) is 2-methoxyacridin-9-amine.
What is the SMILES notation for 2-methoxyacridin-9-amine?
The canonical SMILES for 2-methoxyacridin-9-amine is COc1ccc2nc3ccccc3c(N)c2c1.
What is the InChIKey of 2-methoxyacridin-9-amine?
The InChIKey is MPQHRPVQJUEINF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c1-17-9-6-7-13-11(8-9)14(15)10-4-2-3-5-12(10)16-13/h2-8H,1H3,(H2,15,16).
What are the key properties of 2-methoxyacridin-9-amine?
2-methoxyacridin-9-amine has a molecular weight of 224.26 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyacridin-9-amine is sourced from PubChem (CID 18867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).