C31H28N2O5 — CID 18867345
1'-benzyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18867345) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is 1'-benzyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 1'-benzyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18867345 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 1'-benzyl-2-(3-propan-2-yloxypropyl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | CC(C)OCCCN1C(=O)c2oc3ccccc3c(=O)c2C12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C31H28N2O5/c1-20(2)37-18-10-17-33-29(35)28-26(27(34)22-13-6-9-16-25(22)38-28)31(33)23-14-7-8-15-24(23)32(30(31)36)19-21-11-4-3-5-12-21/h3-9,11-16,20H,10,17-19H2,1-2H3 |
| InChIKey | CRWVSGPLLNFRLG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|