C34H19Cl2FN4O4S2 — CID 18868181
7-chloro-2-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1'-[(2-fluorophenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18868181) has the molecular formula C34H19Cl2FN4O4S2 and a molecular weight of 701.59 g/mol. Its IUPAC name is 7-chloro-2-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1'-[(2-fluorophenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 7-chloro-2-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1'-[(2-fluorophenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18868181 |
| Molecular Formula | C34H19Cl2FN4O4S2 |
| Molecular Weight | 701.59 g/mol |
| Exact Mass | 700.02 |
| IUPAC Name | 7-chloro-2-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1'-[(2-fluorophenyl)methyl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | O=C1c2oc3ccc(Cl)cc3c(=O)c2C2(C(=O)N(Cc3ccccc3F)c3ccccc32)N1c1nnc(SCc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C34H19Cl2FN4O4S2/c35-20-8-5-6-18(14-20)17-46-33-39-38-32(47-33)41-30(43)29-27(28(42)22-15-21(36)12-13-26(22)45-29)34(41)23-9-2-4-11-25(23)40(31(34)44)16-19-7-1-3-10-24(19)37/h1-15H,16-17H2 |
| InChIKey | VXWPILYSZHLAAW-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.59 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|