C35H27N3O6S — CID 18869441
prop-2-enyl 4-methyl-2-[7-methyl-1'-[(3-methylphenyl)methyl]-2',3,9-trioxospiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2-yl]-1,3-thiazole-5-carboxylate (PubChem CID 18869441) has the molecular formula C35H27N3O6S and a molecular weight of 617.68 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-2-[7-methyl-1'-[(3-methylphenyl)methyl]-2',3,9-trioxospiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-2-[7-methyl-1'-[(3-methylphenyl)methyl]-2',3,9-trioxospiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18869441 |
| Molecular Formula | C35H27N3O6S |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | prop-2-enyl 4-methyl-2-[7-methyl-1'-[(3-methylphenyl)methyl]-2',3,9-trioxospiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2-yl]-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)c3oc4ccc(C)cc4c(=O)c3C23C(=O)N(Cc2cccc(C)c2)c2ccccc23)nc1C |
| InChI | InChI=1S/C35H27N3O6S/c1-5-15-43-32(41)30-21(4)36-34(45-30)38-31(40)29-27(28(39)23-17-20(3)13-14-26(23)44-29)35(38)24-11-6-7-12-25(24)37(33(35)42)18-22-10-8-9-19(2)16-22/h5-14,16-17H,1,15,18H2,2-4H3 |
| InChIKey | AYDNULUANKFABT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 110.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|