C36H23Cl3N4O4S2 — CID 18869828
1'-[(4-chlorophenyl)methyl]-2-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18869828) has the molecular formula C36H23Cl3N4O4S2 and a molecular weight of 746.10 g/mol. Its IUPAC name is 1'-[(4-chlorophenyl)methyl]-2-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 1'-[(4-chlorophenyl)methyl]-2-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18869828 |
| Molecular Formula | C36H23Cl3N4O4S2 |
| Molecular Weight | 746.10 g/mol |
| Exact Mass | 744.02 |
| IUPAC Name | 1'-[(4-chlorophenyl)methyl]-2-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6,7-dimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1cc2oc3c(c(=O)c2cc1C)C1(C(=O)N(Cc2ccc(Cl)cc2)c2ccccc21)N(c1nnc(SCc2ccc(Cl)cc2Cl)s1)C3=O |
| InChI | InChI=1S/C36H23Cl3N4O4S2/c1-18-13-24-28(14-19(18)2)47-31-29(30(24)44)36(25-5-3-4-6-27(25)42(33(36)46)16-20-7-10-22(37)11-8-20)43(32(31)45)34-40-41-35(49-34)48-17-21-9-12-23(38)15-26(21)39/h3-15H,16-17H2,1-2H3 |
| InChIKey | ZCFUBBZVBKSPIX-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.10 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|