C20H15N3O3 — CID 18870517
7-methyl-1-[[5-[(E)-2-phenylethenyl]-1,3,4-oxadiazol-2-yl]methyl]indole-2,3-dione (PubChem CID 18870517) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 7-methyl-1-[[5-[(E)-2-phenylethenyl]-1,3,4-oxadiazol-2-yl]methyl]indole-2,3-dione.
| Compound Name | 7-methyl-1-[[5-[(E)-2-phenylethenyl]-1,3,4-oxadiazol-2-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 18870517 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 7-methyl-1-[[5-[(E)-2-phenylethenyl]-1,3,4-oxadiazol-2-yl]methyl]indole-2,3-dione |
| SMILES | Cc1cccc2c1N(Cc1nnc(/C=C/c3ccccc3)o1)C(=O)C2=O |
| InChI | InChI=1S/C20H15N3O3/c1-13-6-5-9-15-18(13)23(20(25)19(15)24)12-17-22-21-16(26-17)11-10-14-7-3-2-4-8-14/h2-11H,12H2,1H3/b11-10+ |
| InChIKey | UPCGWHVLJGYLCG-ZHACJKMWSA-N |
| XLogP | 3.28 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|