C18H12N4O5S — CID 18870768
3-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 18870768) has the molecular formula C18H12N4O5S and a molecular weight of 396.38 g/mol. Its IUPAC name is 3-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 18870768 |
| Molecular Formula | C18H12N4O5S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 3-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(Sc2nnc(-c3cccc([N+](=O)[O-])c3)o2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H12N4O5S/c23-15-10-14(17(24)21(15)12-6-2-1-3-7-12)28-18-20-19-16(27-18)11-5-4-8-13(9-11)22(25)26/h1-9,14H,10H2 |
| InChIKey | ADVONCBSJYHZKS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|