C18H13N5O5S — CID 18870787
3-[[5-(2-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(4-nitrophenyl)pyrrolidine-2,5-dione (PubChem CID 18870787) has the molecular formula C18H13N5O5S and a molecular weight of 411.40 g/mol. Its IUPAC name is 3-[[5-(2-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(4-nitrophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[[5-(2-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(4-nitrophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 18870787 |
| Molecular Formula | C18H13N5O5S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 3-[[5-(2-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(4-nitrophenyl)pyrrolidine-2,5-dione |
| SMILES | Nc1ccccc1-c1nnc(SC2CC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)o1 |
| InChI | InChI=1S/C18H13N5O5S/c19-13-4-2-1-3-12(13)16-20-21-18(28-16)29-14-9-15(24)22(17(14)25)10-5-7-11(8-6-10)23(26)27/h1-8,14H,9,19H2 |
| InChIKey | OWSIBSLQIBEMLI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|