About ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate
ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate (PubChem CID 18871128) has the molecular formula C20H17Cl2NO2
and a molecular weight of 374.27 g/mol. Its IUPAC name is ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate |
| PubChem CID | 18871128 |
| Molecular Formula | C20H17Cl2NO2 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cc2ccc(Cl)c(Cl)c2)c[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C20H17Cl2NO2/c1-2-25-20(24)18-15(10-13-8-9-16(21)17(22)11-13)12-23-19(18)14-6-4-3-5-7-14/h3-9,11-12,23H,2,10H2,1H3 |
| InChIKey | WBVTUDXEXCKTAB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate?
The IUPAC name of ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate (CID 18871128) is ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate.
What is the SMILES notation for ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate?
The canonical SMILES for ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate is CCOC(=O)c1c(Cc2ccc(Cl)c(Cl)c2)c[nH]c1-c1ccccc1.
What is the InChIKey of ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate?
The InChIKey is WBVTUDXEXCKTAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17Cl2NO2/c1-2-25-20(24)18-15(10-13-8-9-16(21)17(22)11-13)12-23-19(18)14-6-4-3-5-7-14/h3-9,11-12,23H,2,10H2,1H3.
What are the key properties of ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate?
ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate has a molecular weight of 374.27 g/mol, XLogP of 5.76, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(3,4-dichlorophenyl)methyl]-2-phenyl-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 18871128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).