C18H12Cl2N4S — CID 18871263
6-[(E)-2-(2,5-dichlorophenyl)ethenyl]-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 18871263) has the molecular formula C18H12Cl2N4S and a molecular weight of 387.30 g/mol. Its IUPAC name is 6-[(E)-2-(2,5-dichlorophenyl)ethenyl]-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[(E)-2-(2,5-dichlorophenyl)ethenyl]-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 18871263 |
| Molecular Formula | C18H12Cl2N4S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 6-[(E)-2-(2,5-dichlorophenyl)ethenyl]-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1ccc(-c2nnc3sc(/C=C/c4cc(Cl)ccc4Cl)nn23)cc1 |
| InChI | InChI=1S/C18H12Cl2N4S/c1-11-2-4-12(5-3-11)17-21-22-18-24(17)23-16(25-18)9-6-13-10-14(19)7-8-15(13)20/h2-10H,1H3/b9-6+ |
| InChIKey | KCIJWGOROWBHOI-RMKNXTFCSA-N |
| XLogP | 5.64 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |